C25H29N3O2 — CID 1055016
3-phenyl-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 1055016) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-phenyl-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1055016 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-phenyl-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1ccc(N2CCCCC2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C25H29N3O2/c29-24(14-11-20-9-3-1-4-10-20)26-21-12-13-23(27-15-5-2-6-16-27)22(19-21)25(30)28-17-7-8-18-28/h1,3-4,9-14,19H,2,5-8,15-18H2,(H,26,29) |
| InChIKey | SFGZIFPPXAFPFK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|