C20H29N3O2 — CID 771523
2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide (PubChem CID 771523) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide |
|---|---|
| PubChem CID | 771523 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(N2CCCC2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-20(2,3)19(25)21-15-8-9-17(22-10-4-5-11-22)16(14-15)18(24)23-12-6-7-13-23/h8-9,14H,4-7,10-13H2,1-3H3,(H,21,25) |
| InChIKey | IGHRXVNOFWZQFZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|