C24H29N3O2 — CID 1059306
3-phenyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide (PubChem CID 1059306) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 3-phenyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide.
| Compound Name | 3-phenyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide |
|---|---|
| PubChem CID | 1059306 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-phenyl-N-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]propanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(N2CCCC2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(13-10-19-8-2-1-3-9-19)25-20-11-12-22(26-14-4-5-15-26)21(18-20)24(29)27-16-6-7-17-27/h1-3,8-9,11-12,18H,4-7,10,13-17H2,(H,25,28) |
| InChIKey | QNCNCGIFNIMCMF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|