C26H33N3O2 — CID 42751211
N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-2-phenylacetamide (PubChem CID 42751211) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-2-phenylacetamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 42751211 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]-2-phenylacetamide |
| SMILES | CC1CCN(c2ccc(NC(=O)Cc3ccccc3)cc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C26H33N3O2/c1-20-12-16-28(17-13-20)24-11-10-22(27-25(30)18-21-8-4-2-5-9-21)19-23(24)26(31)29-14-6-3-7-15-29/h2,4-5,8-11,19-20H,3,6-7,12-18H2,1H3,(H,27,30) |
| InChIKey | PAXJHWRYIBZGNO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|