C26H33N3O2S — CID 1066202
N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]-2-phenylsulfanylacetamide (PubChem CID 1066202) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 1066202 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]-2-phenylsulfanylacetamide |
| SMILES | CC1CCN(C(=O)c2cc(NC(=O)CSc3ccccc3)ccc2N2CCCCC2)CC1 |
| InChI | InChI=1S/C26H33N3O2S/c1-20-12-16-29(17-13-20)26(31)23-18-21(10-11-24(23)28-14-6-3-7-15-28)27-25(30)19-32-22-8-4-2-5-9-22/h2,4-5,8-11,18,20H,3,6-7,12-17,19H2,1H3,(H,27,30) |
| InChIKey | BYICAFMWNBSWDH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|