C29H33N3O2S — CID 92907888
2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]-5-[(2-phenylsulfanylacetyl)amino]benzamide (PubChem CID 92907888) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]-5-[(2-phenylsulfanylacetyl)amino]benzamide.
| Compound Name | 2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]-5-[(2-phenylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 92907888 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]-5-[(2-phenylsulfanylacetyl)amino]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)CSc3ccccc3)cc2C(=O)N[C@@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H33N3O2S/c1-21-15-17-32(18-16-21)27-14-13-24(31-28(33)20-35-25-11-7-4-8-12-25)19-26(27)29(34)30-22(2)23-9-5-3-6-10-23/h3-14,19,21-22H,15-18,20H2,1-2H3,(H,30,34)(H,31,33)/t22-/m0/s1 |
| InChIKey | YAUDQBZHJBZUFJ-QFIPXVFZSA-N |
| XLogP | 6.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|