C28H30Cl2N4O2 — CID 3395530
5-[(2,3-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide (PubChem CID 3395530) has the molecular formula C28H30Cl2N4O2 and a molecular weight of 525.48 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide.
| Compound Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3395530 |
| Molecular Formula | C28H30Cl2N4O2 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)Nc3cccc(Cl)c3Cl)cc2C(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H30Cl2N4O2/c1-18-13-15-34(16-14-18)25-12-11-21(32-28(36)33-24-10-6-9-23(29)26(24)30)17-22(25)27(35)31-19(2)20-7-4-3-5-8-20/h3-12,17-19H,13-16H2,1-2H3,(H,31,35)(H2,32,33,36) |
| InChIKey | SIUVELUJIYQMFX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|