C30H35N3O4 — CID 3884953
2,6-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(1-phenylethylcarbamoyl)phenyl]benzamide (PubChem CID 3884953) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(1-phenylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(1-phenylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3884953 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 2,6-dimethoxy-N-[4-(4-methylpiperidin-1-yl)-3-(1-phenylethylcarbamoyl)phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C30H35N3O4/c1-20-15-17-33(18-16-20)25-14-13-23(32-30(35)28-26(36-3)11-8-12-27(28)37-4)19-24(25)29(34)31-21(2)22-9-6-5-7-10-22/h5-14,19-21H,15-18H2,1-4H3,(H,31,34)(H,32,35) |
| InChIKey | YCGSSDTVQARFRN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|