C40H40N4O3 — CID 3900419
5-[(2,2-diphenylacetyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzamide (PubChem CID 3900419) has the molecular formula C40H40N4O3 and a molecular weight of 624.79 g/mol. Its IUPAC name is 5-[(2,2-diphenylacetyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzamide.
| Compound Name | 5-[(2,2-diphenylacetyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3900419 |
| Molecular Formula | C40H40N4O3 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | 5-[(2,2-diphenylacetyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)C(c3ccccc3)c3ccccc3)cc2C(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C40H40N4O3/c1-29(30-14-6-3-7-15-30)41-39(45)34-28-33(42-40(46)38(31-16-8-4-9-17-31)32-18-10-5-11-19-32)22-23-35(34)43-24-26-44(27-25-43)36-20-12-13-21-37(36)47-2/h3-23,28-29,38H,24-27H2,1-2H3,(H,41,45)(H,42,46) |
| InChIKey | NSBGMOPRCQSRRL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|