C31H38N4O3 — CID 1063445
2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 1063445) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 1063445 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-(3-methylbutanoylamino)-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)CC(C)C)cc2C(=O)N[C@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H38N4O3/c1-22(2)20-30(36)33-25-14-15-27(26(21-25)31(37)32-23(3)24-10-6-5-7-11-24)34-16-18-35(19-17-34)28-12-8-9-13-29(28)38-4/h5-15,21-23H,16-20H2,1-4H3,(H,32,37)(H,33,36)/t23-/m1/s1 |
| InChIKey | LGBDGHCCCZWIBS-HSZRJFAPSA-N |
| XLogP | 5.50 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|