C31H46N4O3 — CID 4546349
5-(decanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide (PubChem CID 4546349) has the molecular formula C31H46N4O3 and a molecular weight of 522.73 g/mol. Its IUPAC name is 5-(decanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide.
| Compound Name | 5-(decanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4546349 |
| Molecular Formula | C31H46N4O3 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 5-(decanoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-propan-2-ylbenzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCN(c3ccccc3OC)CC2)c(C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C31H46N4O3/c1-5-6-7-8-9-10-11-16-30(36)33-25-17-18-27(26(23-25)31(37)32-24(2)3)34-19-21-35(22-20-34)28-14-12-13-15-29(28)38-4/h12-15,17-18,23-24H,5-11,16,19-22H2,1-4H3,(H,32,37)(H,33,36) |
| InChIKey | MYHOHSZNESLRDY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|