C27H37N3O2 — CID 3487078
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(octanoylamino)-N-propan-2-ylbenzamide (PubChem CID 3487078) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(octanoylamino)-N-propan-2-ylbenzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(octanoylamino)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 3487078 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(octanoylamino)-N-propan-2-ylbenzamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C27H37N3O2/c1-4-5-6-7-8-13-26(31)29-23-14-15-25(24(18-23)27(32)28-20(2)3)30-17-16-21-11-9-10-12-22(21)19-30/h9-12,14-15,18,20H,4-8,13,16-17,19H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | LCFFMULAEPOHDP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|