C23H28ClN3O2 — CID 6548979
N-[(2R)-butan-2-yl]-5-[[(2R)-2-chloropropanoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide (PubChem CID 6548979) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-5-[[(2R)-2-chloropropanoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-5-[[(2R)-2-chloropropanoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
|---|---|
| PubChem CID | 6548979 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[(2R)-butan-2-yl]-5-[[(2R)-2-chloropropanoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(NC(=O)[C@@H](C)Cl)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-4-15(2)25-23(29)20-13-19(26-22(28)16(3)24)9-10-21(20)27-12-11-17-7-5-6-8-18(17)14-27/h5-10,13,15-16H,4,11-12,14H2,1-3H3,(H,25,29)(H,26,28)/t15-,16-/m1/s1 |
| InChIKey | CRZAUBJQWFOAFJ-HZPDHXFCSA-N |
| XLogP | 4.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|