C25H33N3O2 — CID 1053998
N-[(2R)-butan-2-yl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-methylbutanoylamino)benzamide (PubChem CID 1053998) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-methylbutanoylamino)benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-methylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 1053998 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3-methylbutanoylamino)benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(NC(=O)CC(C)C)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C25H33N3O2/c1-5-18(4)26-25(30)22-15-21(27-24(29)14-17(2)3)10-11-23(22)28-13-12-19-8-6-7-9-20(19)16-28/h6-11,15,17-18H,5,12-14,16H2,1-4H3,(H,26,30)(H,27,29)/t18-/m1/s1 |
| InChIKey | ABQVVBVOKZVTAO-GOSISDBHSA-N |
| XLogP | 4.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|