C29H41N3O2 — CID 93005842
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzamide (PubChem CID 93005842) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzamide |
|---|---|
| PubChem CID | 93005842 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzamide |
| SMILES | CC(C)CNC(=O)c1cc(NC(=O)C[C@@H](C)CC(C)(C)C)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C29H41N3O2/c1-20(2)18-30-28(34)25-16-24(31-27(33)15-21(3)17-29(4,5)6)11-12-26(25)32-14-13-22-9-7-8-10-23(22)19-32/h7-12,16,20-21H,13-15,17-19H2,1-6H3,(H,30,34)(H,31,33)/t21-/m1/s1 |
| InChIKey | YFRLEOOTQCNWJL-OAQYLSRUSA-N |
| XLogP | 6.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|