C25H43N4O2+ — CID 7129864
dimethyl-[3-[[2-pyrrolidin-1-yl-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzoyl]amino]propyl]azanium (PubChem CID 7129864) has the molecular formula C25H43N4O2+ and a molecular weight of 431.65 g/mol. Its IUPAC name is dimethyl-[3-[[2-pyrrolidin-1-yl-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzoyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[2-pyrrolidin-1-yl-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 7129864 |
| Molecular Formula | C25H43N4O2+ |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | dimethyl-[3-[[2-pyrrolidin-1-yl-5-[[(3S)-3,5,5-trimethylhexanoyl]amino]benzoyl]amino]propyl]azanium |
| SMILES | C[C@H](CC(=O)Nc1ccc(N2CCCC2)c(C(=O)NCCC[NH+](C)C)c1)CC(C)(C)C |
| InChI | InChI=1S/C25H42N4O2/c1-19(18-25(2,3)4)16-23(30)27-20-10-11-22(29-14-7-8-15-29)21(17-20)24(31)26-12-9-13-28(5)6/h10-11,17,19H,7-9,12-16,18H2,1-6H3,(H,26,31)(H,27,30)/p+1/t19-/m1/s1 |
| InChIKey | LISBPEALZIQNPU-LJQANCHMSA-O |
| XLogP | 2.95 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|