C22H37N3O3 — CID 7356424
2-(dimethylamino)-N-(3-methoxypropyl)-5-[[(3R)-3,5,5-trimethylhexanoyl]amino]benzamide (PubChem CID 7356424) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(3-methoxypropyl)-5-[[(3R)-3,5,5-trimethylhexanoyl]amino]benzamide.
| Compound Name | 2-(dimethylamino)-N-(3-methoxypropyl)-5-[[(3R)-3,5,5-trimethylhexanoyl]amino]benzamide |
|---|---|
| PubChem CID | 7356424 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 2-(dimethylamino)-N-(3-methoxypropyl)-5-[[(3R)-3,5,5-trimethylhexanoyl]amino]benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)C[C@H](C)CC(C)(C)C)ccc1N(C)C |
| InChI | InChI=1S/C22H37N3O3/c1-16(15-22(2,3)4)13-20(26)24-17-9-10-19(25(5)6)18(14-17)21(27)23-11-8-12-28-7/h9-10,14,16H,8,11-13,15H2,1-7H3,(H,23,27)(H,24,26)/t16-/m0/s1 |
| InChIKey | MXZYSNIRCXEDNM-INIZCTEOSA-N |
| XLogP | 3.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|