C20H24Cl2N4O3 — CID 4002462
5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(3-methoxypropyl)benzamide (PubChem CID 4002462) has the molecular formula C20H24Cl2N4O3 and a molecular weight of 439.34 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(3-methoxypropyl)benzamide.
| Compound Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4002462 |
| Molecular Formula | C20H24Cl2N4O3 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)Nc2ccc(Cl)c(Cl)c2)ccc1N(C)C |
| InChI | InChI=1S/C20H24Cl2N4O3/c1-26(2)18-8-6-13(11-15(18)19(27)23-9-4-10-29-3)24-20(28)25-14-5-7-16(21)17(22)12-14/h5-8,11-12H,4,9-10H2,1-3H3,(H,23,27)(H2,24,25,28) |
| InChIKey | HYZGIEUWPCOELA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|