C20H24Cl2N4O2 — CID 42659109
5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N,N-diethylbenzamide (PubChem CID 42659109) has the molecular formula C20H24Cl2N4O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N,N-diethylbenzamide.
| Compound Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 42659109 |
| Molecular Formula | C20H24Cl2N4O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2ccc(Cl)c(Cl)c2)ccc1N(C)C |
| InChI | InChI=1S/C20H24Cl2N4O2/c1-5-26(6-2)19(27)15-11-13(8-10-18(15)25(3)4)23-20(28)24-14-7-9-16(21)17(22)12-14/h7-12H,5-6H2,1-4H3,(H2,23,24,28) |
| InChIKey | MWKGFBQKUUTQIX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|