C23H22ClFN4O2 — CID 42659105
N-benzyl-5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-(dimethylamino)benzamide (PubChem CID 42659105) has the molecular formula C23H22ClFN4O2 and a molecular weight of 440.91 g/mol. Its IUPAC name is N-benzyl-5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-(dimethylamino)benzamide.
| Compound Name | N-benzyl-5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 42659105 |
| Molecular Formula | C23H22ClFN4O2 |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-benzyl-5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccc(F)c(Cl)c2)cc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H22ClFN4O2/c1-29(2)21-11-9-16(27-23(31)28-17-8-10-20(25)19(24)13-17)12-18(21)22(30)26-14-15-6-4-3-5-7-15/h3-13H,14H2,1-2H3,(H,26,30)(H2,27,28,31) |
| InChIKey | JAZLFKHYYZHYMM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|