C24H24F2N4O2 — CID 42756324
5-[(3,4-difluorophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-phenylethyl)benzamide (PubChem CID 42756324) has the molecular formula C24H24F2N4O2 and a molecular weight of 438.48 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(3,4-difluorophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42756324 |
| Molecular Formula | C24H24F2N4O2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 5-[(3,4-difluorophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-phenylethyl)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccc(F)c(F)c2)cc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C24H24F2N4O2/c1-30(2)22-11-9-17(28-24(32)29-18-8-10-20(25)21(26)15-18)14-19(22)23(31)27-13-12-16-6-4-3-5-7-16/h3-11,14-15H,12-13H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | CHUNEBZSQJRQPC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|