C21H25N3O2 — CID 42747499
N-cyclopropyl-2-(dimethylamino)-5-(3-phenylpropanoylamino)benzamide (PubChem CID 42747499) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-cyclopropyl-2-(dimethylamino)-5-(3-phenylpropanoylamino)benzamide.
| Compound Name | N-cyclopropyl-2-(dimethylamino)-5-(3-phenylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 42747499 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-cyclopropyl-2-(dimethylamino)-5-(3-phenylpropanoylamino)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)CCc2ccccc2)cc1C(=O)NC1CC1 |
| InChI | InChI=1S/C21H25N3O2/c1-24(2)19-12-11-17(14-18(19)21(26)23-16-9-10-16)22-20(25)13-8-15-6-4-3-5-7-15/h3-7,11-12,14,16H,8-10,13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | VXPWDRHIOISLPD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|