C29H34N2O4 — CID 10205705
2-(dimethylamino)-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]benzoic acid (PubChem CID 10205705) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]benzoic acid.
| Compound Name | 2-(dimethylamino)-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 10205705 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-(dimethylamino)-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]benzoic acid |
| SMILES | CN(C)c1ccc(NC(=O)CCc2ccc(OCCCCCc3ccccc3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C29H34N2O4/c1-31(2)27-18-15-24(21-26(27)29(33)34)30-28(32)19-14-23-12-16-25(17-13-23)35-20-8-4-7-11-22-9-5-3-6-10-22/h3,5-6,9-10,12-13,15-18,21H,4,7-8,11,14,19-20H2,1-2H3,(H,30,32)(H,33,34) |
| InChIKey | GKYCVCMDPQUHGG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|