C30H35NO5 — CID 71043442
methyl 2-[2-methoxy-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]phenyl]acetate (PubChem CID 71043442) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is methyl 2-[2-methoxy-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]phenyl]acetate.
| Compound Name | methyl 2-[2-methoxy-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 71043442 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | methyl 2-[2-methoxy-5-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(NC(=O)CCc2ccc(OCCCCCc3ccccc3)cc2)ccc1OC |
| InChI | InChI=1S/C30H35NO5/c1-34-28-18-15-26(21-25(28)22-30(33)35-2)31-29(32)19-14-24-12-16-27(17-13-24)36-20-8-4-7-11-23-9-5-3-6-10-23/h3,5-6,9-10,12-13,15-18,21H,4,7-8,11,14,19-20,22H2,1-2H3,(H,31,32) |
| InChIKey | SYOZWZFZVOMOBK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|