C21H28N2O3 — CID 13424076
1-methoxy-1-methyl-3-[4-(6-phenylhexoxy)phenyl]urea (PubChem CID 13424076) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-methoxy-1-methyl-3-[4-(6-phenylhexoxy)phenyl]urea.
| Compound Name | 1-methoxy-1-methyl-3-[4-(6-phenylhexoxy)phenyl]urea |
|---|---|
| PubChem CID | 13424076 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-methoxy-1-methyl-3-[4-(6-phenylhexoxy)phenyl]urea |
| SMILES | CON(C)C(=O)Nc1ccc(OCCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O3/c1-23(25-2)21(24)22-19-13-15-20(16-14-19)26-17-9-4-3-6-10-18-11-7-5-8-12-18/h5,7-8,11-16H,3-4,6,9-10,17H2,1-2H3,(H,22,24) |
| InChIKey | STYXOKUCZZBTEL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|