C22H29ClN2O2 — CID 20566600
3-[3-chloro-4-(7-phenylheptoxy)phenyl]-1,1-dimethylurea (PubChem CID 20566600) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 3-[3-chloro-4-(7-phenylheptoxy)phenyl]-1,1-dimethylurea.
| Compound Name | 3-[3-chloro-4-(7-phenylheptoxy)phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 20566600 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[3-chloro-4-(7-phenylheptoxy)phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(OCCCCCCCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H29ClN2O2/c1-25(2)22(26)24-19-14-15-21(20(23)17-19)27-16-10-5-3-4-7-11-18-12-8-6-9-13-18/h6,8-9,12-15,17H,3-5,7,10-11,16H2,1-2H3,(H,24,26) |
| InChIKey | DZRMHRYNKLNIGS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|