C18H20BrClN2O2 — CID 54097189
3-[4-(3-bromo-3-phenylpropoxy)-3-chlorophenyl]-1,1-dimethylurea (PubChem CID 54097189) has the molecular formula C18H20BrClN2O2 and a molecular weight of 411.73 g/mol. Its IUPAC name is 3-[4-(3-bromo-3-phenylpropoxy)-3-chlorophenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-(3-bromo-3-phenylpropoxy)-3-chlorophenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 54097189 |
| Molecular Formula | C18H20BrClN2O2 |
| Molecular Weight | 411.73 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 3-[4-(3-bromo-3-phenylpropoxy)-3-chlorophenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(OCCC(Br)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C18H20BrClN2O2/c1-22(2)18(23)21-14-8-9-17(16(20)12-14)24-11-10-15(19)13-6-4-3-5-7-13/h3-9,12,15H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | MXYJQEMKXJBRJT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|