C19H24ClN3O2 — CID 119862026
2-amino-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylpropanamide (PubChem CID 119862026) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 2-amino-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylpropanamide.
| Compound Name | 2-amino-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 119862026 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-amino-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylpropanamide |
| SMILES | CN(C)CCOc1ccc(NC(=O)C(N)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H24ClN3O2/c1-23(2)10-11-25-18-9-8-15(13-16(18)20)22-19(24)17(21)12-14-6-4-3-5-7-14/h3-9,13,17H,10-12,21H2,1-2H3,(H,22,24) |
| InChIKey | ZVLLXONKPPJMDR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |