C16H16Cl3N3O2 — CID 86964022
2,6-dichloro-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]pyridine-4-carboxamide (PubChem CID 86964022) has the molecular formula C16H16Cl3N3O2 and a molecular weight of 388.68 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 86964022 |
| Molecular Formula | C16H16Cl3N3O2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2,6-dichloro-N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]pyridine-4-carboxamide |
| SMILES | CN(C)CCOc1ccc(NC(=O)c2cc(Cl)nc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C16H16Cl3N3O2/c1-22(2)5-6-24-13-4-3-11(9-12(13)17)20-16(23)10-7-14(18)21-15(19)8-10/h3-4,7-9H,5-6H2,1-2H3,(H,20,23) |
| InChIKey | MJVFTNSQLVBKEP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|