C16H16Cl2N2O4 — CID 86930838
2,6-dichloro-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide (PubChem CID 86930838) has the molecular formula C16H16Cl2N2O4 and a molecular weight of 371.22 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 86930838 |
| Molecular Formula | C16H16Cl2N2O4 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2,6-dichloro-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]pyridine-4-carboxamide |
| SMILES | COCCOc1cc(NC(=O)c2cc(Cl)nc(Cl)c2)ccc1OC |
| InChI | InChI=1S/C16H16Cl2N2O4/c1-22-5-6-24-13-9-11(3-4-12(13)23-2)19-16(21)10-7-14(17)20-15(18)8-10/h3-4,7-9H,5-6H2,1-2H3,(H,19,21) |
| InChIKey | LIZLQGUFZPVSGV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|