C16H21N3O4S — CID 120622378
2-(2-aminoethyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 120622378) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 120622378 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(2-aminoethyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCOc1cc(NC(=O)c2csc(CCN)n2)ccc1OC |
| InChI | InChI=1S/C16H21N3O4S/c1-21-7-8-23-14-9-11(3-4-13(14)22-2)18-16(20)12-10-24-15(19-12)5-6-17/h3-4,9-10H,5-8,17H2,1-2H3,(H,18,20) |
| InChIKey | VEMASEDXYZJOKQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|