C17H23N3O3S — CID 119679447
2-(aminomethyl)-N-(3,4-dipropoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 119679447) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3,4-dipropoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(3,4-dipropoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119679447 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(aminomethyl)-N-(3,4-dipropoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)c2csc(CN)n2)cc1OCCC |
| InChI | InChI=1S/C17H23N3O3S/c1-3-7-22-14-6-5-12(9-15(14)23-8-4-2)19-17(21)13-11-24-16(10-18)20-13/h5-6,9,11H,3-4,7-8,10,18H2,1-2H3,(H,19,21) |
| InChIKey | UTAIKTYTDNNTST-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |