C11H9BrIN3OS — CID 113266598
2-(aminomethyl)-N-(3-bromo-4-iodophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 113266598) has the molecular formula C11H9BrIN3OS and a molecular weight of 438.09 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-bromo-4-iodophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(3-bromo-4-iodophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 113266598 |
| Molecular Formula | C11H9BrIN3OS |
| Molecular Weight | 438.09 g/mol |
| Exact Mass | 436.87 |
| IUPAC Name | 2-(aminomethyl)-N-(3-bromo-4-iodophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2ccc(I)c(Br)c2)cs1 |
| InChI | InChI=1S/C11H9BrIN3OS/c12-7-3-6(1-2-8(7)13)15-11(17)9-5-18-10(4-14)16-9/h1-3,5H,4,14H2,(H,15,17) |
| InChIKey | MQPMCSCYINMVEQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.09 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|