C11H10BrN3O2S — CID 81494297
2-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 81494297) has the molecular formula C11H10BrN3O2S and a molecular weight of 328.19 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 81494297 |
| Molecular Formula | C11H10BrN3O2S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2cccc(Br)c2O)cs1 |
| InChI | InChI=1S/C11H10BrN3O2S/c12-6-2-1-3-7(10(6)16)15-11(17)8-5-18-9(4-13)14-8/h1-3,5,16H,4,13H2,(H,15,17) |
| InChIKey | LTBKQPABYQDPKR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|