C16H22N4O2S — CID 119885857
2-(aminomethyl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 119885857) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119885857 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-(aminomethyl)-N-[3-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)CCCOc1cccc(NC(=O)c2csc(CN)n2)c1 |
| InChI | InChI=1S/C16H22N4O2S/c1-20(2)7-4-8-22-13-6-3-5-12(9-13)18-16(21)14-11-23-15(10-17)19-14/h3,5-6,9,11H,4,7-8,10,17H2,1-2H3,(H,18,21) |
| InChIKey | HOHXVFROFTZBTH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|