C15H18ClN3O2S — CID 119739739
2-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 119739739) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119739739 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(3-chlorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(CCCOc1cccc(Cl)c1)C(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-19(15(20)13-10-22-14(9-17)18-13)6-3-7-21-12-5-2-4-11(16)8-12/h2,4-5,8,10H,3,6-7,9,17H2,1H3 |
| InChIKey | DGJRKOKWTVCWMV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|