C16H21ClFN3O2S — CID 120623568
2-(2-aminoethyl)-N-[3-(4-fluorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 120623568) has the molecular formula C16H21ClFN3O2S and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[3-(4-fluorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-N-[3-(4-fluorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120623568 |
| Molecular Formula | C16H21ClFN3O2S |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(2-aminoethyl)-N-[3-(4-fluorophenoxy)propyl]-N-methyl-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CN(CCCOc1ccc(F)cc1)C(=O)c1csc(CCN)n1.Cl |
| InChI | InChI=1S/C16H20FN3O2S.ClH/c1-20(16(21)14-11-23-15(19-14)7-8-18)9-2-10-22-13-5-3-12(17)4-6-13;/h3-6,11H,2,7-10,18H2,1H3;1H |
| InChIKey | QQKVETBQYVWDJB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|