C17H24ClN3O4S2 — CID 120626193
2-(2-aminoethyl)-N-methyl-N-[3-(4-methylsulfonylphenoxy)propyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 120626193) has the molecular formula C17H24ClN3O4S2 and a molecular weight of 433.98 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-methyl-N-[3-(4-methylsulfonylphenoxy)propyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-N-methyl-N-[3-(4-methylsulfonylphenoxy)propyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120626193 |
| Molecular Formula | C17H24ClN3O4S2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-(2-aminoethyl)-N-methyl-N-[3-(4-methylsulfonylphenoxy)propyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CN(CCCOc1ccc(S(C)(=O)=O)cc1)C(=O)c1csc(CCN)n1.Cl |
| InChI | InChI=1S/C17H23N3O4S2.ClH/c1-20(17(21)15-12-25-16(19-15)8-9-18)10-3-11-24-13-4-6-14(7-5-13)26(2,22)23;/h4-7,12H,3,8-11,18H2,1-2H3;1H |
| InChIKey | MFVQCPVWXFWHQU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|