C19H25ClN2O4S — CID 120626191
5-amino-N,2-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]benzamide;hydrochloride (PubChem CID 120626191) has the molecular formula C19H25ClN2O4S and a molecular weight of 412.94 g/mol. Its IUPAC name is 5-amino-N,2-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]benzamide;hydrochloride.
| Compound Name | 5-amino-N,2-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120626191 |
| Molecular Formula | C19H25ClN2O4S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 5-amino-N,2-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N(C)CCCOc1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C19H24N2O4S.ClH/c1-14-5-6-15(20)13-18(14)19(22)21(2)11-4-12-25-16-7-9-17(10-8-16)26(3,23)24;/h5-10,13H,4,11-12,20H2,1-3H3;1H |
| InChIKey | GXLFHKHGLRRBFX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|