C18H23ClN2O3 — CID 120618208
5-amino-N-[2-(4-methoxyphenoxy)ethyl]-N,2-dimethylbenzamide;hydrochloride (PubChem CID 120618208) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 5-amino-N-[2-(4-methoxyphenoxy)ethyl]-N,2-dimethylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-[2-(4-methoxyphenoxy)ethyl]-N,2-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120618208 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-amino-N-[2-(4-methoxyphenoxy)ethyl]-N,2-dimethylbenzamide;hydrochloride |
| SMILES | COc1ccc(OCCN(C)C(=O)c2cc(N)ccc2C)cc1.Cl |
| InChI | InChI=1S/C18H22N2O3.ClH/c1-13-4-5-14(19)12-17(13)18(21)20(2)10-11-23-16-8-6-15(22-3)7-9-16;/h4-9,12H,10-11,19H2,1-3H3;1H |
| InChIKey | LYJOZWFSDKCHIE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|