C18H21ClN2O2 — CID 120624386
5-amino-N-[3-(3-chlorophenoxy)propyl]-N,2-dimethylbenzamide (PubChem CID 120624386) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 5-amino-N-[3-(3-chlorophenoxy)propyl]-N,2-dimethylbenzamide.
| Compound Name | 5-amino-N-[3-(3-chlorophenoxy)propyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 120624386 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 5-amino-N-[3-(3-chlorophenoxy)propyl]-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)N(C)CCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-13-7-8-15(20)12-17(13)18(22)21(2)9-4-10-23-16-6-3-5-14(19)11-16/h3,5-8,11-12H,4,9-10,20H2,1-2H3 |
| InChIKey | NSGGJOQCVUJAAO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|