C24H23ClN2O4 — CID 56549046
4-[4-[3-(3-chlorophenoxy)propyl-methylcarbamoyl]phenoxy]benzamide (PubChem CID 56549046) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is 4-[4-[3-(3-chlorophenoxy)propyl-methylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[3-(3-chlorophenoxy)propyl-methylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56549046 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4-[4-[3-(3-chlorophenoxy)propyl-methylcarbamoyl]phenoxy]benzamide |
| SMILES | CN(CCCOc1cccc(Cl)c1)C(=O)c1ccc(Oc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C24H23ClN2O4/c1-27(14-3-15-30-22-5-2-4-19(25)16-22)24(29)18-8-12-21(13-9-18)31-20-10-6-17(7-11-20)23(26)28/h2,4-13,16H,3,14-15H2,1H3,(H2,26,28) |
| InChIKey | RHIADTZCNUINML-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|