C16H16ClN5O2 — CID 71853795
N-[3-(3-chlorophenoxy)propyl]-N-methyltetrazolo[1,5-a]pyridine-6-carboxamide (PubChem CID 71853795) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is N-[3-(3-chlorophenoxy)propyl]-N-methyltetrazolo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N-[3-(3-chlorophenoxy)propyl]-N-methyltetrazolo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 71853795 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[3-(3-chlorophenoxy)propyl]-N-methyltetrazolo[1,5-a]pyridine-6-carboxamide |
| SMILES | CN(CCCOc1cccc(Cl)c1)C(=O)c1ccc2nnnn2c1 |
| InChI | InChI=1S/C16H16ClN5O2/c1-21(8-3-9-24-14-5-2-4-13(17)10-14)16(23)12-6-7-15-18-19-20-22(15)11-12/h2,4-7,10-11H,3,8-9H2,1H3 |
| InChIKey | LMKFITKWUWOPLN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|