C17H22ClN3O4S — CID 55955665
N-[3-(3-chlorophenoxy)propyl]-N,1-dimethyl-4-(methylsulfamoyl)pyrrole-2-carboxamide (PubChem CID 55955665) has the molecular formula C17H22ClN3O4S and a molecular weight of 399.90 g/mol. Its IUPAC name is N-[3-(3-chlorophenoxy)propyl]-N,1-dimethyl-4-(methylsulfamoyl)pyrrole-2-carboxamide.
| Compound Name | N-[3-(3-chlorophenoxy)propyl]-N,1-dimethyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55955665 |
| Molecular Formula | C17H22ClN3O4S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-[3-(3-chlorophenoxy)propyl]-N,1-dimethyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N(C)CCCOc2cccc(Cl)c2)n(C)c1 |
| InChI | InChI=1S/C17H22ClN3O4S/c1-19-26(23,24)15-11-16(21(3)12-15)17(22)20(2)8-5-9-25-14-7-4-6-13(18)10-14/h4,6-7,10-12,19H,5,8-9H2,1-3H3 |
| InChIKey | DKXHMWJTWDWIEI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|