About N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine
N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 17460797) has the molecular formula C13H13ClN6O
and a molecular weight of 304.74 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 17460797 |
| Molecular Formula | C13H13ClN6O |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CN(CCOc1cccc(Cl)c1)c1ccc2nnnn2n1 |
| InChI | InChI=1S/C13H13ClN6O/c1-19(7-8-21-11-4-2-3-10(14)9-11)13-6-5-12-15-17-18-20(12)16-13/h2-6,9H,7-8H2,1H3 |
| InChIKey | DOEYEMROYWJEKF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine (CID 17460797) is N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine is CN(CCOc1cccc(Cl)c1)c1ccc2nnnn2n1.
What is the InChIKey of N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is DOEYEMROYWJEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN6O/c1-19(7-8-21-11-4-2-3-10(14)9-11)13-6-5-12-15-17-18-20(12)16-13/h2-6,9H,7-8H2,1H3.
What are the key properties of N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine?
N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 304.74 g/mol, XLogP of 1.69, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-chlorophenoxy)ethyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 17460797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).