C16H16Cl2N2O2 — CID 24528515
1-[2-(3-chlorophenoxy)ethyl]-3-(3-chlorophenyl)-1-methylurea (PubChem CID 24528515) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-3-(3-chlorophenyl)-1-methylurea.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-3-(3-chlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 24528515 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-3-(3-chlorophenyl)-1-methylurea |
| SMILES | CN(CCOc1cccc(Cl)c1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-20(8-9-22-15-7-3-5-13(18)11-15)16(21)19-14-6-2-4-12(17)10-14/h2-7,10-11H,8-9H2,1H3,(H,19,21) |
| InChIKey | AUYIJCPEIQHLSX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |