C13H17Cl2NO2 — CID 55110390
3-chloro-N-[2-(3-chlorophenoxy)ethyl]-N,2-dimethylpropanamide (PubChem CID 55110390) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-chloro-N-[2-(3-chlorophenoxy)ethyl]-N,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-(3-chlorophenoxy)ethyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 55110390 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-chloro-N-[2-(3-chlorophenoxy)ethyl]-N,2-dimethylpropanamide |
| SMILES | CC(CCl)C(=O)N(C)CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-10(9-14)13(17)16(2)6-7-18-12-5-3-4-11(15)8-12/h3-5,8,10H,6-7,9H2,1-2H3 |
| InChIKey | ASVXEVCPKUDYNK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|