C15H23ClN2O2 — CID 61165412
(2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide (PubChem CID 61165412) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide.
| Compound Name | (2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 61165412 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S)-2-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N(C)CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O2/c1-11(2)9-14(17)15(19)18(3)7-8-20-13-6-4-5-12(16)10-13/h4-6,10-11,14H,7-9,17H2,1-3H3/t14-/m0/s1 |
| InChIKey | LSBYKFWRVHRCIO-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |