C17H29ClN2O4S — CID 119753772
(2S)-2-amino-N,4-dimethyl-N-[3-(3-methylsulfonylphenoxy)propyl]pentanamide;hydrochloride (PubChem CID 119753772) has the molecular formula C17H29ClN2O4S and a molecular weight of 392.95 g/mol. Its IUPAC name is (2S)-2-amino-N,4-dimethyl-N-[3-(3-methylsulfonylphenoxy)propyl]pentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N,4-dimethyl-N-[3-(3-methylsulfonylphenoxy)propyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119753772 |
| Molecular Formula | C17H29ClN2O4S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (2S)-2-amino-N,4-dimethyl-N-[3-(3-methylsulfonylphenoxy)propyl]pentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N(C)CCCOc1cccc(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C17H28N2O4S.ClH/c1-13(2)11-16(18)17(20)19(3)9-6-10-23-14-7-5-8-15(12-14)24(4,21)22;/h5,7-8,12-13,16H,6,9-11,18H2,1-4H3;1H/t16-;/m0./s1 |
| InChIKey | XFHPMXBRILPTIS-NTISSMGPSA-N |
| XLogP | 2.11 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|