C15H23ClN2O4S2 — CID 119306128
N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119306128) has the molecular formula C15H23ClN2O4S2 and a molecular weight of 394.95 g/mol. Its IUPAC name is N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119306128 |
| Molecular Formula | C15H23ClN2O4S2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-methyl-N-[3-(3-methylsulfonylphenoxy)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CN(CCCOc1cccc(S(C)(=O)=O)c1)C(=O)C1CSCN1.Cl |
| InChI | InChI=1S/C15H22N2O4S2.ClH/c1-17(15(18)14-10-22-11-16-14)7-4-8-21-12-5-3-6-13(9-12)23(2,19)20;/h3,5-6,9,14,16H,4,7-8,10-11H2,1-2H3;1H |
| InChIKey | SKZVNRYFGNTTIB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|